* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX120271 |
English Synonyms: | WUXIAPPTEC WX120271 |
MDL Number.: | MFCD19442480 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOC(=O)[C@@H]1[C@@H]2CC[C@H](N1C(=O)OC(C)(C)C)CC2=O |
InChi: | InChI=1S/C15H23NO5/c1-5-20-13(18)12-10-7-6-9(8-11(10)17)16(12)14(19)21-15(2,3)4/h9-10,12H,5-8H2,1-4H3/t9-,10+,12-/m0/s1 |
InChiKey: | InChIKey=VSHIYGMRWBFMTP-UMNHJUIQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.