* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110667 |
English Synonyms: | WUXIAPPTEC WX110667 |
MDL Number.: | MFCD19442486 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)CN2C[C@@H]3[C@H](C2)[C@@H]3CO |
InChi: | InChI=1S/C13H17NO/c15-9-13-11-7-14(8-12(11)13)6-10-4-2-1-3-5-10/h1-5,11-13,15H,6-9H2/t11-,12+,13- |
InChiKey: | InChIKey=NMJRXNUMGKZPHG-CLLJXQQHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.