* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110663 |
English Synonyms: | WUXIAPPTEC WX110663 |
MDL Number.: | MFCD19442508 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | CCOC(=O)[C@H]1C[C@H]2[C@H](C1)OCCN2C(=O)OC(C)(C)C |
InChi: | InChI=1S/C15H25NO5/c1-5-19-13(17)10-8-11-12(9-10)20-7-6-16(11)14(18)21-15(2,3)4/h10-12H,5-9H2,1-4H3/t10-,11-,12-/m0/s1 |
InChiKey: | InChIKey=RLBZVNJGAHTMMY-SRVKXCTJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.