* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-2-METHYL-1,5-NAPHTHYRIDINE |
| CAS: | 911389-21-4 |
| English Synonyms: | 8-CHLORO-2-METHYL-1,5-NAPHTHYRIDINE |
| MDL Number.: | MFCD19690237 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | Cc1ccc2c(n1)c(ccn2)Cl |
| InChi: | InChI=1S/C9H7ClN2/c1-6-2-3-8-9(12-6)7(10)4-5-11-8/h2-5H,1H3 |
| InChiKey: | InChIKey=GGHHDIKBFBPFHO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.