Molecular Structure:
CCD No.:CCD05212565
KD 5170
CAS No.:
940943-37-3
Formula:C20 H25 N3 O5 S2
MolWeight:451.565
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | KD 5170 |
| CAS： | 940943-37-3 |
| English Synonyms： | KD 5170 |
| MDL Number.： | MFCD19690928 |
| H bond acceptor： | 8 |
| H bond donor： | 1 |
| Smile： | CC(=O)SCC(=O)c1ccc(nc1)NS(=O)(=O)c2ccc(cc2)OCCCN(C)C |
| InChi： | InChI=1S/C20H25N3O5S2/c1-15(24)29-14-19(25)16-5-10-20(21-13-16)22-30(26,27)18-8-6-17(7-9-18)28-12-4-11-23(2)3/h5-10,13H,4,11-12,14H2,1-3H3,(H,21,22) |
| InChiKey： | InChIKey=KXWBUKMWZKTHCV-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
