* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | JNJ 10181457 DIHYDROCHLORIDE |
CAS: | 544707-19-9 |
English Synonyms: | JNJ 10181457 DIHYDROCHLORIDE |
MDL Number.: | MFCD19690930 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | c1cc(cc(c1)C#CCCN2CCCCC2)CN3CCOCC3.Cl.Cl |
InChi: | InChI=1S/C20H28N2O.2ClH/c1-3-10-21(11-4-1)12-5-2-7-19-8-6-9-20(17-19)18-22-13-15-23-16-14-22;;/h6,8-9,17H,1,3-5,10-16,18H2;2*1H |
InChiKey: | InChIKey=PAQHERKZFLOHCA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.