* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KP372-1 |
| CAS: | 329710-24-9 |
| English Synonyms: | KP372-1 |
| MDL Number.: | MFCD19705529 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)-c3c(nn4c(n3)nnn4)C2=O.c1ccc2c(c1)-c3c(nc4nnnn4n3)C2=O |
| InChi: | InChI=1S/2C10H4N6O/c17-9-6-4-2-1-3-5(6)7-8(9)11-10-12-14-15-16(10)13-7;17-9-6-4-2-1-3-5(6)7-8(9)13-16-10(11-7)12-14-15-16/h2*1-4H |
| InChiKey: | InChIKey=CWFOAASSUQIXOW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.