* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WXFS0408 |
English Synonyms: | WUXIAPPTEC WXFS0408 |
MDL Number.: | MFCD20230600 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C[C@@]2(CNC[C@@]2(C1)F)F |
InChi: | InChI=1S/C11H18F2N2O2/c1-9(2,3)17-8(16)15-6-10(12)4-14-5-11(10,13)7-15/h14H,4-7H2,1-3H3/t10-,11+ |
InChiKey: | InChIKey=GSLDUMZCENENRO-PHIMTYICSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.