* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX110940 |
English Synonyms: | WUXIAPPTEC WX110940 |
MDL Number.: | MFCD20230911 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1CCC[C@@]2(CN(C[C@@H]2C1)C(=O)OCc3ccccc3)C(=O)O |
InChi: | InChI=1S/C22H30N2O6/c1-21(2,3)30-20(28)23-11-7-10-22(18(25)26)15-24(13-17(22)12-23)19(27)29-14-16-8-5-4-6-9-16/h4-6,8-9,17H,7,10-15H2,1-3H3,(H,25,26)/t17-,22-/m0/s1 |
InChiKey: | InChIKey=KMYVMXWXVVMPFH-JTSKRJEESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.