* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX115785 |
English Synonyms: | WUXIAPPTEC WX115785 |
MDL Number.: | MFCD20230973 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cc1ccc(cc1)S(=O)(=O)N2CC3=C(C2)[C@@H]4CNS(=O)(=O)[C@@H]4CC3 |
InChi: | InChI=1S/C16H20N2O4S2/c1-11-2-5-13(6-3-11)24(21,22)18-9-12-4-7-16-14(15(12)10-18)8-17-23(16,19)20/h2-3,5-6,14,16-17H,4,7-10H2,1H3/t14-,16+/m0/s1 |
InChiKey: | InChIKey=BLAHAZOGZYPHSN-GOEBONIOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.