* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX116005 |
English Synonyms: | WUXIAPPTEC WX116005 |
MDL Number.: | MFCD20231054 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc2c(c1)[C@H]3CNC[C@@H]3C(=O)N2 |
InChi: | InChI=1S/C11H12N2O/c14-11-9-6-12-5-8(9)7-3-1-2-4-10(7)13-11/h1-4,8-9,12H,5-6H2,(H,13,14)/t8-,9+/m1/s1 |
InChiKey: | InChIKey=SVVRUBYEHXZLPQ-BDAKNGLRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.