* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX120021 |
English Synonyms: | WUXIAPPTEC WX120021 |
MDL Number.: | MFCD20231272 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC(C)(C)OC(=O)N1C2CC([C@H]1C(=O)O)[C@@H](C2)O |
InChi: | InChI=1S/C12H19NO5/c1-12(2,3)18-11(17)13-6-4-7(8(14)5-6)9(13)10(15)16/h6-9,14H,4-5H2,1-3H3,(H,15,16)/t6?,7?,8-,9+/m1/s1 |
InChiKey: | InChIKey=SDTKFYMBKIVOOR-YNTFGVKOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.