* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXIAPPTEC WX120038 |
English Synonyms: | WUXIAPPTEC WX120038 |
MDL Number.: | MFCD20231321 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CC(C)(C)OC(=O)N1C2CCC([C@H]1C(=O)O)[C@H](C2)F |
InChi: | InChI=1S/C13H20FNO4/c1-13(2,3)19-12(18)15-7-4-5-8(9(14)6-7)10(15)11(16)17/h7-10H,4-6H2,1-3H3,(H,16,17)/t7?,8?,9-,10-/m0/s1 |
InChiKey: | InChIKey=GCKMOPJWHFGWIO-QLEHZGMVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.