* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GRIFOLIC ACID |
CAS: | 80557-12-6 |
English Synonyms: | GRIFOLIC ACID |
MDL Number.: | MFCD20260370 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | Cc1cc(c(c(c1C(=O)O)O)C/C=C(\C)/CC/C=C(\C)/CCC=C(C)C)O |
InChi: | InChI=1S/C23H32O4/c1-15(2)8-6-9-16(3)10-7-11-17(4)12-13-19-20(24)14-18(5)21(22(19)25)23(26)27/h8,10,12,14,24-25H,6-7,9,11,13H2,1-5H3,(H,26,27)/b16-10+,17-12+ |
InChiKey: | InChIKey=QPIZDZGIXDKCRC-JTCWOHKRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.