* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XEROPHILUSIN G |
| CAS: | 304642-94-2 |
| English Synonyms: | XEROPHILUSIN G |
| MDL Number.: | MFCD20260377 |
| H bond acceptor: | 8 |
| H bond donor: | 4 |
| Smile: | CC(=O)OC[C@@]1(CC[C@H]([C@]23[C@@H]1[C@@H]([C@]([C@]45[C@H]2CC[C@H]([C@H]4O)C(=C)C5=O)(OC3)O)O)O)C |
| InChi: | InChI=1S/C22H30O8/c1-10-12-4-5-13-20-9-30-22(28,21(13,16(10)25)17(12)26)18(27)15(20)19(3,7-6-14(20)24)8-29-11(2)23/h12-15,17-18,24,26-28H,1,4-9H2,2-3H3/t12-,13-,14+,15+,17+,18-,19-,20+,21-,22+/m0/s1 |
| InChiKey: | InChIKey=WXIZMFKMNALSKU-BWCLEITDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.