* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JACEIDIN |
| CAS: | 10173-01-0 |
| English Synonyms: | JACEIDIN |
| MDL Number.: | MFCD20260420 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | COc1cc(ccc1O)c2c(c(=O)c3c(o2)cc(c(c3O)OC)O)OC |
| InChi: | InChI=1S/C18H16O8/c1-23-11-6-8(4-5-9(11)19)16-18(25-3)15(22)13-12(26-16)7-10(20)17(24-2)14(13)21/h4-7,19-21H,1-3H3 |
| InChiKey: | InChIKey=XUWTZJRCCPNNJR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.