* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VOMIFOLIOL |
| CAS: | 23526-45-6 |
| English Synonyms: | BUEMENOL A ; VOMIFOLIOL |
| MDL Number.: | MFCD20260591 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | CC1=CC(=O)CC([C@]1(/C=C/[C@@H](C)O)O)(C)C |
| InChi: | InChI=1S/C13H20O3/c1-9-7-11(15)8-12(3,4)13(9,16)6-5-10(2)14/h5-7,10,14,16H,8H2,1-4H3/b6-5+/t10-,13-/m1/s1 |
| InChiKey: | InChIKey=KPQMCAKZRXOZLB-KOIHBYQTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.