* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLUTINONE |
CAS: | 508-09-8 |
English Synonyms: | GLUTINONE |
MDL Number.: | MFCD20260715 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | CC1(CC[C@@]2(CC[C@@]3([C@H]4CC=C5[C@H]([C@@]4(CC[C@]3([C@@H]2C1)C)C)CCC(=O)C5(C)C)C)C)C |
InChi: | InChI=1S/C30H48O/c1-25(2)13-14-27(5)15-17-29(7)22-11-9-20-21(10-12-24(31)26(20,3)4)28(22,6)16-18-30(29,8)23(27)19-25/h9,21-23H,10-19H2,1-8H3/t21-,22+,23-,27-,28+,29-,30+/m1/s1 |
InChiKey: | InChIKey=XUPCBKGIPJPDGW-VZTATICASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.