* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VANDRIKIDINE |
| CAS: | 50656-92-3 |
| English Synonyms: | VANDRIKIDINE |
| MDL Number.: | MFCD20260742 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | C[C@H]([C@]12CC(=C3[C@@]4([C@H]1N(CC4)CC=C2)c5ccc(cc5N3)OC)C(=O)OC)O |
| InChi: | InChI=1S/C22H26N2O4/c1-13(25)21-7-4-9-24-10-8-22(20(21)24)16-6-5-14(27-2)11-17(16)23-18(22)15(12-21)19(26)28-3/h4-7,11,13,20,23,25H,8-10,12H2,1-3H3/t13-,20+,21+,22+/m1/s1 |
| InChiKey: | InChIKey=ASAFZNAXYPDIJR-MCLJMYSDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.