* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WILFOROL C |
CAS: | 168254-95-3 |
English Synonyms: | WILFOROL C |
MDL Number.: | MFCD20260873 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@H]([C@@]5(C)CO)O)C)C)[C@@H]2C1)C)C(=O)O)C |
InChi: | InChI=1S/C30H48O4/c1-25(2)13-15-30(24(33)34)16-14-28(5)19(20(30)17-25)7-8-22-26(3)11-10-23(32)27(4,18-31)21(26)9-12-29(22,28)6/h7,20-23,31-32H,8-18H2,1-6H3,(H,33,34)/t20-,21+,22+,23+,26-,27-,28+,29+,30-/m0/s1 |
InChiKey: | InChIKey=PGOYMURMZNDHNS-ZBXZNUPFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.