* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VINIFEROL D |
| CAS: | 625096-18-6 |
| English Synonyms: | VINIFEROL D |
| MDL Number.: | MFCD20274787 |
| H bond acceptor: | 9 |
| H bond donor: | 8 |
| Smile: | c1cc(ccc1[C@@H]2c3c(cc(cc3O)O)[C@@H]4c5c(cc(c6c5[C@@H]2[C@@H]([C@H]6c7ccc(cc7)O)c8cc(cc(c8)O)O)O)O[C@@H]4c9ccc(cc9)O)O |
| InChi: | InChI=1S/C42H32O9/c43-23-7-1-19(2-8-23)33-35(22-13-26(46)15-27(47)14-22)40-34(20-3-9-24(44)10-4-20)36-29(16-28(48)17-30(36)49)37-39-32(18-31(50)38(33)41(39)40)51-42(37)21-5-11-25(45)12-6-21/h1-18,33-35,37,40,42-50H/t33-,34-,35-,37-,40+,42-/m1/s1 |
| InChiKey: | InChIKey=QDEHKEFWCRAFDN-MOTQTELBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.