* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLAUCIN B |
CAS: | 115458-73-6 |
English Synonyms: | GLAUCIN B |
MDL Number.: | MFCD20274883 |
H bond acceptor: | 10 |
H bond donor: | 0 |
Smile: | CC(=O)O[C@H]1[C@@H]2C(O[C@@H]3[C@]2(COC(=O)C3)[C@H]4CC[C@]5([C@@H](OC(=O)C6C5([C@@]4(C1=O)C)O6)c7ccoc7)C)(C)C |
InChi: | InChI=1S/C28H32O10/c1-13(29)35-18-19-24(2,3)37-16-10-17(30)34-12-27(16,19)15-6-8-25(4)21(14-7-9-33-11-14)36-23(32)22-28(25,38-22)26(15,5)20(18)31/h7,9,11,15-16,18-19,21-22H,6,8,10,12H2,1-5H3/t15-,16-,18-,19+,21-,22?,25-,26-,27-,28?/m0/s1 |
InChiKey: | InChIKey=IHOHGVDNDQTZGL-FIBRIUCFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.