* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUININE ASCORBATE |
| CAS: | 146-40-7 |
| English Synonyms: | QUININE ASCORBATE |
| MDL Number.: | MFCD20488092 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CC[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](c3ccnc4c3cc(cc4)OC)O.C([C@H]([C@@H]1C(=C(C(=O)O1)O)O)O)O |
| InChi: | InChI=1S/C20H26N2O2.C6H8O6/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18;7-1-2(8)5-3(9)4(10)6(11)12-5/h4-6,8,11,13-14,19-20,23H,3,7,9-10,12H2,1-2H3;2,5,7-10H,1H2/t13-,14-,19-,20+;2-,5-/m01/s1 |
| InChiKey: | InChIKey=WEPGUJRYQHJETE-YHXKXQDLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.