* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOLINE-3,6-DIAMINE |
| English Synonyms: | QUINOLINE-3,6-DIAMINE |
| MDL Number.: | MFCD20704709 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1N)cc(cn2)N |
| InChi: | InChI=1S/C9H9N3/c10-7-1-2-9-6(3-7)4-8(11)5-12-9/h1-5H,10-11H2 |
| InChiKey: | InChIKey=NJOLJFORGJDQKW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.