* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | QUINAZOLINE-2,4,7-TRIAMINE |
English Synonyms: | QUINAZOLINE-2,4,7-TRIAMINE |
MDL Number.: | MFCD20706407 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1cc2c(cc1N)nc(nc2N)N |
InChi: | InChI=1S/C8H9N5/c9-4-1-2-5-6(3-4)12-8(11)13-7(5)10/h1-3H,9H2,(H4,10,11,12,13) |
InChiKey: | InChIKey=INLZNSPYKJXGEK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.