* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KUSHENOL A |
| English Synonyms: | KUSHENOL A |
| MDL Number.: | MFCD21333212 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CC(=CC[C@H](Cc1c(cc(c2c1O[C@@H](CC2=O)c3ccccc3O)O)O)C(=C)C)C |
| InChi: | InChI=1S/C25H28O5/c1-14(2)9-10-16(15(3)4)11-18-20(27)12-21(28)24-22(29)13-23(30-25(18)24)17-7-5-6-8-19(17)26/h5-9,12,16,23,26-28H,3,10-11,13H2,1-2,4H3/t16-,23+/m1/s1 |
| InChiKey: | InChIKey=OGBMVWVBHWHRGD-MWTRTKDXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.