* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KUSHENOL I |
| English Synonyms: | KUSHENOL I |
| MDL Number.: | MFCD21333213 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | CC(=CC[C@H](Cc1c(cc(c2c1O[C@@H]([C@H](C2=O)O)c3ccc(cc3O)O)OC)O)C(=C)C)C |
| InChi: | InChI=1S/C26H30O7/c1-13(2)6-7-15(14(3)4)10-18-20(29)12-21(32-5)22-23(30)24(31)26(33-25(18)22)17-9-8-16(27)11-19(17)28/h6,8-9,11-12,15,24,26-29,31H,3,7,10H2,1-2,4-5H3/t15-,24+,26-/m1/s1 |
| InChiKey: | InChIKey=QKEDJCCCNZWOBS-SGOPFIAHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.