* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VICENIN-3 |
| English Synonyms: | VICENIN-3 |
| MDL Number.: | MFCD21333257 |
| H bond acceptor: | 14 |
| H bond donor: | 10 |
| Smile: | c1cc(ccc1c2cc(=O)c3c(c(c(c(c3o2)[C@H]4[C@@H]([C@H]([C@@H](CO4)O)O)O)O)[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O |
| InChi: | InChI=1S/C26H28O14/c27-6-13-18(32)21(35)23(37)26(40-13)15-19(33)14-10(29)5-12(8-1-3-9(28)4-2-8)39-24(14)16(20(15)34)25-22(36)17(31)11(30)7-38-25/h1-5,11,13,17-18,21-23,25-28,30-37H,6-7H2/t11-,13-,17+,18-,21+,22-,23-,25+,26+/m1/s1 |
| InChiKey: | InChIKey=MMDUKUSNQNWVET-MCIQUCDDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.