* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | KUGUACIN A |
English Synonyms: | KUGUACIN A |
MDL Number.: | MFCD21333281 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | C[C@H](C/C=C/C(C)(C)O)C1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2C(=O)C=C4[C@H]3CC[C@@H](C4(C)C)O)C=O)C)C |
InChi: | InChI=1S/C30H46O4/c1-19(9-8-13-26(2,3)34)20-12-14-29(7)25-23(32)17-22-21(10-11-24(33)27(22,4)5)30(25,18-31)16-15-28(20,29)6/h8,13,17-21,24-25,33-34H,9-12,14-16H2,1-7H3/b13-8+/t19-,20?,21-,24+,25+,28-,29+,30-/m1/s1 |
InChiKey: | InChIKey=HJGYRKQQQWEVSH-KOSWBYHVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.