* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KUGUACIN G |
| English Synonyms: | KUGUACIN G |
| MDL Number.: | MFCD21333285 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | C[C@H](CC(=O)CC(C)(C)O)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2C(=O)[C@H]4[C@@]5([C@H]3CCC(=O)C5(C)C)O4)C=O)C)C |
| InChi: | InChI=1S/C30H44O6/c1-17(14-18(32)15-25(2,3)35)19-10-11-28(7)23-22(34)24-30(36-24)20(8-9-21(33)26(30,4)5)29(23,16-31)13-12-27(19,28)6/h16-17,19-20,23-24,35H,8-15H2,1-7H3/t17-,19-,20+,23+,24+,27-,28+,29-,30-/m1/s1 |
| InChiKey: | InChIKey=FXSHCBSQWAENEL-VUNLVITCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.