* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KUGUACIN H |
| English Synonyms: | KUGUACIN H |
| MDL Number.: | MFCD21333286 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | C[C@H](CC(=O)CC(C)(C)O)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2C(=O)C=C4[C@H]3CCC(=O)C4(C)C)C=O)C)C |
| InChi: | InChI=1S/C30H44O5/c1-18(14-19(32)16-26(2,3)35)20-10-11-29(7)25-23(33)15-22-21(8-9-24(34)27(22,4)5)30(25,17-31)13-12-28(20,29)6/h15,17-18,20-21,25,35H,8-14,16H2,1-7H3/t18-,20-,21-,25+,28-,29+,30-/m1/s1 |
| InChiKey: | InChIKey=WNMQUAQQKAOULJ-DMWOMKCJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.