* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KUGUACIN R |
| English Synonyms: | KUGUACIN R |
| MDL Number.: | MFCD21333290 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | C[C@H](C/C=C/C(C)(C)O)[C@H]1CC[C@@]2([C@@]1(CCC34[C@H]2C=C[C@]5([C@H]3CC[C@@H](C5(C)C)O)O[C@@H]4O)C)C |
| InChi: | InChI=1S/C30H48O4/c1-19(9-8-14-25(2,3)33)20-12-15-28(7)21-13-16-30-22(10-11-23(31)26(30,4)5)29(21,24(32)34-30)18-17-27(20,28)6/h8,13-14,16,19-24,31-33H,9-12,15,17-18H2,1-7H3/b14-8+/t19-,20-,21+,22+,23+,24+,27-,28+,29?,30-/m1/s1 |
| InChiKey: | InChIKey=PAZKUEDDPDHJSO-GQICCVOZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.