* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KUGUACIN F |
| English Synonyms: | KUGUACIN F |
| MDL Number.: | MFCD21333296 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | C[C@H](CC(=O)C=C(C)C)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2C(=O)C4[C@@]5([C@H]3CCC(=O)C5(C)C)O4)C=O)C)C |
| InChi: | InChI=1S/C30H42O5/c1-17(2)14-19(32)15-18(3)20-10-11-28(7)24-23(34)25-30(35-25)21(8-9-22(33)26(30,4)5)29(24,16-31)13-12-27(20,28)6/h14,16,18,20-21,24-25H,8-13,15H2,1-7H3/t18-,20-,21+,24+,25?,27-,28+,29-,30-/m1/s1 |
| InChiKey: | InChIKey=QWTHMZHAIKJOPN-HABRBPAZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.