* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KUGUACIN Q |
| English Synonyms: | KUGUACIN Q |
| MDL Number.: | MFCD21333300 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCOC1C23CC[C@@]4([C@H](CC[C@]4([C@@H]2C(=O)C[C@]5([C@H]3CCC(=O)C5(C)C)O1)C)[C@H](C)CC(=O)C)C |
| InChi: | InChI=1S/C29H44O5/c1-8-33-24-28-14-13-26(6)19(17(2)15-18(3)30)11-12-27(26,7)23(28)20(31)16-29(34-24)21(28)9-10-22(32)25(29,4)5/h17,19,21,23-24H,8-16H2,1-7H3/t17-,19-,21+,23+,24?,26-,27+,28?,29-/m1/s1 |
| InChiKey: | InChIKey=GZCDSZKNRYAXTC-IJJOQNPWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.