* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | KUGUACIN D |
| English Synonyms: | KUGUACIN D |
| MDL Number.: | MFCD21333304 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | C[C@H](CC(=O)C)[C@H]1CC[C@@]2([C@@]1(CC[C@@]3([C@H]2C(=O)C=C4[C@H]3CC[C@@H](C4(C)C)O)C=O)C)C |
| InChi: | InChI=1S/C27H40O4/c1-16(13-17(2)29)18-9-10-26(6)23-21(30)14-20-19(7-8-22(31)24(20,3)4)27(23,15-28)12-11-25(18,26)5/h14-16,18-19,22-23,31H,7-13H2,1-6H3/t16-,18-,19-,22+,23+,25-,26+,27-/m1/s1 |
| InChiKey: | InChIKey=NBODFSYIUFTBQG-CZNZDDFTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.