* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL WUXINP01036 |
| English Synonyms: | WUXI-NATURAL WUXINP01036 |
| MDL Number.: | MFCD21333356 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | CC1=Cc2c(cc(c(c2O)OC)O)[C@]3(C1[C@]4(CC[C@]5(CC[C@@](CC5[C@@]4(CC3)C)(C)C(=O)O)C)C)C |
| InChi: | InChI=1S/C30H42O5/c1-17-14-18-19(15-20(31)23(35-7)22(18)32)28(4)11-13-29(5)21-16-27(3,25(33)34)9-8-26(21,2)10-12-30(29,6)24(17)28/h14-15,21,24,31-32H,8-13,16H2,1-7H3,(H,33,34)/t21?,24?,26-,27-,28+,29+,30-/m1/s1 |
| InChiKey: | InChIKey=DFWYXXZDSSTIKI-YKUQEMIQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.