* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL WUXINP01038 |
| English Synonyms: | WUXI-NATURAL WUXINP01038 |
| MDL Number.: | MFCD21333358 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | C[C@]12CC[C@@](CC1[C@@]3(CC[C@]4(C5=CC(=O)C(=C(C5=C(C=C4[C@]3(CC2)C)O)O)O)C)C)(C)C(=O)O |
| InChi: | InChI=1S/C28H36O6/c1-24-6-7-25(2,23(33)34)14-19(24)28(5)11-9-26(3)15-12-17(30)21(31)22(32)20(15)16(29)13-18(26)27(28,4)10-8-24/h12-13,19,29,31-32H,6-11,14H2,1-5H3,(H,33,34)/t19?,24-,25-,26+,27-,28+/m1/s1 |
| InChiKey: | InChIKey=BDBMWOXJSYMJMF-TWQRTPDCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.