* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WILFOROL A |
| English Synonyms: | WILFOROL A |
| MDL Number.: | MFCD21333359 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | Cc1c2c(cc(c1O)O)[C@@]3(CC[C@]4(C5C[C@](CC[C@@]5(CC[C@@]4(C3=CC2=O)C)C)(C)C(=O)O)C)C |
| InChi: | InChI=1S/C29H38O5/c1-16-22-17(13-19(31)23(16)32)27(4)10-12-29(6)21-15-26(3,24(33)34)8-7-25(21,2)9-11-28(29,5)20(27)14-18(22)30/h13-14,21,31-32H,7-12,15H2,1-6H3,(H,33,34)/t21?,25-,26-,27+,28-,29+/m1/s1 |
| InChiKey: | InChIKey=MIQDJLKXHZPMHH-YRJYRXJBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.