* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | WUXI-NATURAL WUXINP01045 |
| English Synonyms: | WUXI-NATURAL WUXINP01045 |
| MDL Number.: | MFCD21333365 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COc1cc(cc2c1OCC2c3cc(c(c(c3)OC)O)OC)/C=C/CO |
| InChi: | InChI=1S/C20H22O6/c1-23-16-9-13(10-17(24-2)19(16)22)15-11-26-20-14(15)7-12(5-4-6-21)8-18(20)25-3/h4-5,7-10,15,21-22H,6,11H2,1-3H3/b5-4+ |
| InChiKey: | InChIKey=LFKOLBNCHWAZCY-SNAWJCMRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.