* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01051 |
English Synonyms: | WUXI-NATURAL WUXINP01051 |
MDL Number.: | MFCD21333370 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C/C(=C\c1c-2nc3ccccc3c2ccn1C)/CC/C=C(\C)/CO |
InChi: | InChI=1S/C21H24N2O/c1-15(7-6-8-16(2)14-24)13-20-21-18(11-12-23(20)3)17-9-4-5-10-19(17)22-21/h4-5,8-13,24H,6-7,14H2,1-3H3/b15-13+,16-8+ |
InChiKey: | InChIKey=UVTOPKRWAHSCKD-DHZDYVSMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.