* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01112 |
English Synonyms: | WUXI-NATURAL WUXINP01112 |
MDL Number.: | MFCD21333388 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CC1(C2C[C@@H]([C@@]3([C@@H](CC[C@]([C@]3([C@@H]2O)O1)(C)O)OC(=O)c4cccnc4)C)OC(=O)/C=C/c5ccccc5)C |
InChi: | InChI=1S/C30H35NO7/c1-27(2)21-17-23(36-24(32)13-12-19-9-6-5-7-10-19)29(4)22(37-26(34)20-11-8-16-31-18-20)14-15-28(3,35)30(29,38-27)25(21)33/h5-13,16,18,21-23,25,33,35H,14-15,17H2,1-4H3/b13-12+/t21?,22-,23+,25-,28+,29+,30+/m1/s1 |
InChiKey: | InChIKey=BONXYQYBVCBQEW-VPCVYMDTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.