* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01114 |
English Synonyms: | WUXI-NATURAL WUXINP01114 |
MDL Number.: | MFCD21333390 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CC(=O)O[C@@H]1C2C[C@@H]([C@]3([C@]1([C@@](CC[C@@H]3OC(=O)/C=C/c4ccccc4)(C)O)OC2(C)C)C)OC(=O)c5ccccc5 |
InChi: | InChI=1S/C33H38O8/c1-21(34)38-28-24-20-26(40-29(36)23-14-10-7-11-15-23)32(5)25(39-27(35)17-16-22-12-8-6-9-13-22)18-19-31(4,37)33(28,32)41-30(24,2)3/h6-17,24-26,28,37H,18-20H2,1-5H3/b17-16+/t24?,25-,26-,28+,31-,32-,33-/m0/s1 |
InChiKey: | InChIKey=SSKVMQODQQFBMU-PLUOGHSPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.