* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01116 |
English Synonyms: | WUXI-NATURAL WUXINP01116 |
MDL Number.: | MFCD21333392 |
H bond acceptor: | 10 |
H bond donor: | 1 |
Smile: | CC1(C2C[C@@H]([C@@]3([C@H](CC[C@]([C@]3([C@@H]2OC(=O)c4cccnc4)O1)(C)O)OC(=O)/C=C/c5ccccc5)C)OC(=O)c6ccoc6)C |
InChi: | InChI=1S/C35H37NO9/c1-32(2)25-19-27(43-31(39)24-15-18-41-21-24)34(4)26(42-28(37)13-12-22-9-6-5-7-10-22)14-16-33(3,40)35(34,45-32)29(25)44-30(38)23-11-8-17-36-20-23/h5-13,15,17-18,20-21,25-27,29,40H,14,16,19H2,1-4H3/b13-12+/t25?,26-,27-,29+,33-,34-,35-/m0/s1 |
InChiKey: | InChIKey=SQIJZMIYLCEISG-OJGCAQSTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.