* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01117 |
English Synonyms: | WUXI-NATURAL WUXINP01117 |
MDL Number.: | MFCD21333393 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | CC1(C2C[C@@H]([C@@]3([C@H](CC[C@]([C@]3([C@@H]2OC(=O)c4cccnc4)O1)(C)O)OC(=O)c5ccccc5)C)OC(=O)/C=C/c6ccccc6)C |
InChi: | InChI=1S/C37H39NO8/c1-34(2)27-22-29(43-30(39)18-17-24-12-7-5-8-13-24)36(4)28(44-32(40)25-14-9-6-10-15-25)19-20-35(3,42)37(36,46-34)31(27)45-33(41)26-16-11-21-38-23-26/h5-18,21,23,27-29,31,42H,19-20,22H2,1-4H3/b18-17+/t27?,28-,29-,31+,35-,36-,37-/m0/s1 |
InChiKey: | InChIKey=WQWQXHJOHCKMLS-PCJGWIMCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.