* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01242 |
English Synonyms: | WUXI-NATURAL WUXINP01242 |
MDL Number.: | MFCD21333445 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)C1=Cc2ccc3c(c2C(=O)C1=O)CCC(C3(C)C)O |
InChi: | InChI=1S/C19H22O3/c1-10(2)13-9-11-5-7-14-12(16(11)18(22)17(13)21)6-8-15(20)19(14,3)4/h5,7,9-10,15,20H,6,8H2,1-4H3 |
InChiKey: | InChIKey=OMGJFBPQIQBUMF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.