* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01315 |
English Synonyms: | WUXI-NATURAL WUXINP01315 |
MDL Number.: | MFCD21333492 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | C[C@@H]1C2C3=CCC4[C@]([C@@]3(CC[C@]2(CCC1=C)C(=O)O)C)(CCC5[C@@]4(C[C@H]([C@H]([C@@]5(C)CO)O)O)C)C |
InChi: | InChI=1S/C30H46O5/c1-17-9-12-30(25(34)35)14-13-28(5)19(23(30)18(17)2)7-8-22-26(3)15-20(32)24(33)27(4,16-31)21(26)10-11-29(22,28)6/h7,18,20-24,31-33H,1,8-16H2,2-6H3,(H,34,35)/t18-,20+,21?,22?,23?,24+,26-,27-,28+,29+,30-/m0/s1 |
InChiKey: | InChIKey=FFMVHFPLIIYYNC-ZFHJHZFXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.