* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01342 |
English Synonyms: | WUXI-NATURAL WUXINP01342 |
MDL Number.: | MFCD21333511 |
H bond acceptor: | 4 |
H bond donor: | 3 |
Smile: | C[C@@H]1C2C3=CCC4[C@]([C@@]3(CC[C@]2(CCC1=C)C(=O)O)C)(CCC5[C@@]4(C[C@H]([C@H](C5(C)C)O)O)C)C |
InChi: | InChI=1S/C30H46O4/c1-17-10-13-30(25(33)34)15-14-28(6)19(23(30)18(17)2)8-9-22-27(5)16-20(31)24(32)26(3,4)21(27)11-12-29(22,28)7/h8,18,20-24,31-32H,1,9-16H2,2-7H3,(H,33,34)/t18-,20+,21?,22?,23?,24+,27-,28+,29+,30-/m0/s1 |
InChiKey: | InChIKey=PYUUJQUMSQBUIN-ILRHGSFFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.