* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01343 |
English Synonyms: | WUXI-NATURAL WUXINP01343 |
MDL Number.: | MFCD21333512 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@H](C(=O)C5(C)C)O)C)C)C2[C@]1(C)O)C)C(=O)O |
InChi: | InChI=1S/C30H46O5/c1-17-10-13-30(24(33)34)15-14-27(5)18(22(30)29(17,7)35)8-9-21-26(4)16-19(31)23(32)25(2,3)20(26)11-12-28(21,27)6/h8,17,19-22,31,35H,9-16H2,1-7H3,(H,33,34)/t17-,19-,20?,21?,22?,26+,27-,28-,29-,30+/m1/s1 |
InChiKey: | InChIKey=LJORXTIGOHMBOS-IHJFDKSJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.