* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01351 |
English Synonyms: | WUXI-NATURAL WUXINP01351 |
MDL Number.: | MFCD21333519 |
H bond acceptor: | 5 |
H bond donor: | 4 |
Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CCC4[C@]3(CCC5[C@@]4(C[C@H]([C@H](C5(C)C)O)O)C)C)C2[C@@H]1O)C)C(=O)O)C |
InChi: | InChI=1S/C30H48O5/c1-25(2)12-14-30(24(34)35)15-13-28(6)17(21(30)23(25)33)8-9-20-27(5)16-18(31)22(32)26(3,4)19(27)10-11-29(20,28)7/h8,18-23,31-33H,9-16H2,1-7H3,(H,34,35)/t18-,19?,20?,21?,22-,23+,27+,28-,29-,30+/m1/s1 |
InChiKey: | InChIKey=XJMYUPJDAFKICJ-HZCXZNGRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.