* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WUXI-NATURAL WUXINP01362 |
English Synonyms: | WUXI-NATURAL WUXINP01362 |
MDL Number.: | MFCD21333526 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | COc1cc2c(cc1O)c(=O)c(c(o2)c3ccccc3O)O |
InChi: | InChI=1S/C16H12O6/c1-21-13-7-12-9(6-11(13)18)14(19)15(20)16(22-12)8-4-2-3-5-10(8)17/h2-7,17-18,20H,1H3 |
InChiKey: | InChIKey=OOYRITWOLPQHLA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.